C19H23Cl2N5 — CID 10715520
8-(2,4-dichlorophenyl)-2,7-dimethyl-N,N-dipropylpyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 10715520) has the molecular formula C19H23Cl2N5 and a molecular weight of 392.33 g/mol. Its IUPAC name is 8-(2,4-dichlorophenyl)-2,7-dimethyl-N,N-dipropylpyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | 8-(2,4-dichlorophenyl)-2,7-dimethyl-N,N-dipropylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 10715520 |
| Molecular Formula | C19H23Cl2N5 |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 8-(2,4-dichlorophenyl)-2,7-dimethyl-N,N-dipropylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | CCCN(CCC)c1nc(C)nc2c(-c3ccc(Cl)cc3Cl)c(C)nn12 |
| InChI | InChI=1S/C19H23Cl2N5/c1-5-9-25(10-6-2)19-23-13(4)22-18-17(12(3)24-26(18)19)15-8-7-14(20)11-16(15)21/h7-8,11H,5-6,9-10H2,1-4H3 |
| InChIKey | SYQGYRLMXJKTNE-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |