C28H29ClN4O3 — CID 22177759
N-(1,3-benzodioxol-5-ylmethyl)-10-(2-chloro-4-methoxyphenyl)-11-methyl-N-propyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 22177759) has the molecular formula C28H29ClN4O3 and a molecular weight of 505.02 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-10-(2-chloro-4-methoxyphenyl)-11-methyl-N-propyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-10-(2-chloro-4-methoxyphenyl)-11-methyl-N-propyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 22177759 |
| Molecular Formula | C28H29ClN4O3 |
| Molecular Weight | 505.02 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-10-(2-chloro-4-methoxyphenyl)-11-methyl-N-propyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | CCCN(Cc1ccc2c(c1)OCO2)c1c2c(nc3c(-c4ccc(OC)cc4Cl)c(C)nn13)CCC2 |
| InChI | InChI=1S/C28H29ClN4O3/c1-4-12-32(15-18-8-11-24-25(13-18)36-16-35-24)28-21-6-5-7-23(21)30-27-26(17(2)31-33(27)28)20-10-9-19(34-3)14-22(20)29/h8-11,13-14H,4-7,12,15-16H2,1-3H3 |
| InChIKey | CYOAMKQHJQDWSZ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 61.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.02 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |