C21H25ClN4O3 — CID 70842633
10-(2-chloro-4-methoxyphenyl)-N-ethyl-N-(2-methoxyethyl)-11-methyl-5-oxa-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 70842633) has the molecular formula C21H25ClN4O3 and a molecular weight of 416.91 g/mol. Its IUPAC name is 10-(2-chloro-4-methoxyphenyl)-N-ethyl-N-(2-methoxyethyl)-11-methyl-5-oxa-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | 10-(2-chloro-4-methoxyphenyl)-N-ethyl-N-(2-methoxyethyl)-11-methyl-5-oxa-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 70842633 |
| Molecular Formula | C21H25ClN4O3 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 10-(2-chloro-4-methoxyphenyl)-N-ethyl-N-(2-methoxyethyl)-11-methyl-5-oxa-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | CCN(CCOC)c1c2c(nc3c(-c4ccc(OC)cc4Cl)c(C)nn13)COC2 |
| InChI | InChI=1S/C21H25ClN4O3/c1-5-25(8-9-27-3)21-16-11-29-12-18(16)23-20-19(13(2)24-26(20)21)15-7-6-14(28-4)10-17(15)22/h6-7,10H,5,8-9,11-12H2,1-4H3 |
| InChIKey | QYNHFEMYCNETRC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 61.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |