C24H27ClN4O2 — CID 22178053
N-but-2-ynyl-10-(2-chloro-4-methoxyphenyl)-N-(2-methoxyethyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 22178053) has the molecular formula C24H27ClN4O2 and a molecular weight of 438.96 g/mol. Its IUPAC name is N-but-2-ynyl-10-(2-chloro-4-methoxyphenyl)-N-(2-methoxyethyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | N-but-2-ynyl-10-(2-chloro-4-methoxyphenyl)-N-(2-methoxyethyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 22178053 |
| Molecular Formula | C24H27ClN4O2 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N-but-2-ynyl-10-(2-chloro-4-methoxyphenyl)-N-(2-methoxyethyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | CC#CCN(CCOC)c1c2c(nc3c(-c4ccc(OC)cc4Cl)c(C)nn13)CCC2 |
| InChI | InChI=1S/C24H27ClN4O2/c1-5-6-12-28(13-14-30-3)24-19-8-7-9-21(19)26-23-22(16(2)27-29(23)24)18-11-10-17(31-4)15-20(18)25/h10-11,15H,7-9,12-14H2,1-4H3 |
| InChIKey | WXJWKTDTCODJOD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 51.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|