C24H29ClN4O — CID 22178056
10-(4-methoxy-2-methylphenyl)-11-methyl-N,N-bis(prop-2-enyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride (PubChem CID 22178056) has the molecular formula C24H29ClN4O and a molecular weight of 424.98 g/mol. Its IUPAC name is 10-(4-methoxy-2-methylphenyl)-11-methyl-N,N-bis(prop-2-enyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride.
| Compound Name | 10-(4-methoxy-2-methylphenyl)-11-methyl-N,N-bis(prop-2-enyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride |
|---|---|
| PubChem CID | 22178056 |
| Molecular Formula | C24H29ClN4O |
| Molecular Weight | 424.98 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 10-(4-methoxy-2-methylphenyl)-11-methyl-N,N-bis(prop-2-enyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride |
| SMILES | C=CCN(CC=C)c1c2c(nc3c(-c4ccc(OC)cc4C)c(C)nn13)CCC2.Cl |
| InChI | InChI=1S/C24H28N4O.ClH/c1-6-13-27(14-7-2)24-20-9-8-10-21(20)25-23-22(17(4)26-28(23)24)19-12-11-18(29-5)15-16(19)3;/h6-7,11-12,15H,1-2,8-10,13-14H2,3-5H3;1H |
| InChIKey | RMGKXVWZNRDAAH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.98 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|