C24H31N5O2 — CID 22177964
N-[(2E)-2-methoxyiminoethyl]-10-(4-methoxy-2-methylphenyl)-11-methyl-N-propyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 22177964) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is N-[(2E)-2-methoxyiminoethyl]-10-(4-methoxy-2-methylphenyl)-11-methyl-N-propyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | N-[(2E)-2-methoxyiminoethyl]-10-(4-methoxy-2-methylphenyl)-11-methyl-N-propyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 22177964 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | N-[(2E)-2-methoxyiminoethyl]-10-(4-methoxy-2-methylphenyl)-11-methyl-N-propyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | CCCN(C/C=N/OC)c1c2c(nc3c(-c4ccc(OC)cc4C)c(C)nn13)CCC2 |
| InChI | InChI=1S/C24H31N5O2/c1-6-13-28(14-12-25-31-5)24-20-8-7-9-21(20)26-23-22(17(3)27-29(23)24)19-11-10-18(30-4)15-16(19)2/h10-12,15H,6-9,13-14H2,1-5H3/b25-12+ |
| InChIKey | MGOZCGSZGFIQOX-BRJLIKDPSA-N |
| XLogP | 4.36 |
| TPSA | 64.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|