C17H16ClN3O — CID 141108788
10-(2-chloro-4-methoxyphenyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene (PubChem CID 141108788) has the molecular formula C17H16ClN3O and a molecular weight of 313.79 g/mol. Its IUPAC name is 10-(2-chloro-4-methoxyphenyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene.
| Compound Name | 10-(2-chloro-4-methoxyphenyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
|---|---|
| PubChem CID | 141108788 |
| Molecular Formula | C17H16ClN3O |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 10-(2-chloro-4-methoxyphenyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
| SMILES | COc1ccc(-c2c(C)nn3cc4c(nc23)CCC4)c(Cl)c1 |
| InChI | InChI=1S/C17H16ClN3O/c1-10-16(13-7-6-12(22-2)8-14(13)18)17-19-15-5-3-4-11(15)9-21(17)20-10/h6-9H,3-5H2,1-2H3 |
| InChIKey | PTLVPVJKXKMTTN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |