C29H35ClN4O4S — CID 23113348
10-(2-chloro-4-methoxyphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;4-methylbenzenesulfonic acid (PubChem CID 23113348) has the molecular formula C29H35ClN4O4S and a molecular weight of 571.14 g/mol. Its IUPAC name is 10-(2-chloro-4-methoxyphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;4-methylbenzenesulfonic acid.
| Compound Name | 10-(2-chloro-4-methoxyphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 23113348 |
| Molecular Formula | C29H35ClN4O4S |
| Molecular Weight | 571.14 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | 10-(2-chloro-4-methoxyphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;4-methylbenzenesulfonic acid |
| SMILES | CCC(CC)Nc1c2c(nc3c(-c4ccc(OC)cc4Cl)c(C)nn13)CCC2.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C22H27ClN4O.C7H8O3S/c1-5-14(6-2)24-21-17-8-7-9-19(17)25-22-20(13(3)26-27(21)22)16-11-10-15(28-4)12-18(16)23;1-6-2-4-7(5-3-6)11(8,9)10/h10-12,14,24H,5-9H2,1-4H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | JSMUYLUIUIYGMK-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.14 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|