C28H33ClN4O — CID 22177792
10-(4-methoxy-2-methylphenyl)-N-pentan-3-yl-11-phenyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride (PubChem CID 22177792) has the molecular formula C28H33ClN4O and a molecular weight of 477.05 g/mol. Its IUPAC name is 10-(4-methoxy-2-methylphenyl)-N-pentan-3-yl-11-phenyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride.
| Compound Name | 10-(4-methoxy-2-methylphenyl)-N-pentan-3-yl-11-phenyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride |
|---|---|
| PubChem CID | 22177792 |
| Molecular Formula | C28H33ClN4O |
| Molecular Weight | 477.05 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 10-(4-methoxy-2-methylphenyl)-N-pentan-3-yl-11-phenyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride |
| SMILES | CCC(CC)Nc1c2c(nc3c(-c4ccc(OC)cc4C)c(-c4ccccc4)nn13)CCC2.Cl |
| InChI | InChI=1S/C28H32N4O.ClH/c1-5-20(6-2)29-27-23-13-10-14-24(23)30-28-25(22-16-15-21(33-4)17-18(22)3)26(31-32(27)28)19-11-8-7-9-12-19;/h7-9,11-12,15-17,20,29H,5-6,10,13-14H2,1-4H3;1H |
| InChIKey | FIIFITHYXIKDRO-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.05 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |