C24H25ClN4O2 — CID 67406034
5-chloro-6-[11-methyl-2-(pentan-3-ylamino)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-10-yl]indene-1,3-dione (PubChem CID 67406034) has the molecular formula C24H25ClN4O2 and a molecular weight of 436.94 g/mol. Its IUPAC name is 5-chloro-6-[11-methyl-2-(pentan-3-ylamino)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-10-yl]indene-1,3-dione.
| Compound Name | 5-chloro-6-[11-methyl-2-(pentan-3-ylamino)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-10-yl]indene-1,3-dione |
|---|---|
| PubChem CID | 67406034 |
| Molecular Formula | C24H25ClN4O2 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 5-chloro-6-[11-methyl-2-(pentan-3-ylamino)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-10-yl]indene-1,3-dione |
| SMILES | CCC(CC)Nc1c2c(nc3c(-c4cc5c(cc4Cl)C(=O)CC5=O)c(C)nn13)CCC2 |
| InChI | InChI=1S/C24H25ClN4O2/c1-4-13(5-2)26-23-14-7-6-8-19(14)27-24-22(12(3)28-29(23)24)17-9-15-16(10-18(17)25)21(31)11-20(15)30/h9-10,13,26H,4-8,11H2,1-3H3 |
| InChIKey | RNFIAHUPTWXHTL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|