C25H27ClN4O — CID 23567878
N-but-2-ynyl-10-(2-chloro-4-methoxyphenyl)-N-(cyclopropylmethyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 23567878) has the molecular formula C25H27ClN4O and a molecular weight of 434.97 g/mol. Its IUPAC name is N-but-2-ynyl-10-(2-chloro-4-methoxyphenyl)-N-(cyclopropylmethyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | N-but-2-ynyl-10-(2-chloro-4-methoxyphenyl)-N-(cyclopropylmethyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 23567878 |
| Molecular Formula | C25H27ClN4O |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | N-but-2-ynyl-10-(2-chloro-4-methoxyphenyl)-N-(cyclopropylmethyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | CC#CCN(CC1CC1)c1c2c(nc3c(-c4ccc(OC)cc4Cl)c(C)nn13)CCC2 |
| InChI | InChI=1S/C25H27ClN4O/c1-4-5-13-29(15-17-9-10-17)25-20-7-6-8-22(20)27-24-23(16(2)28-30(24)25)19-12-11-18(31-3)14-21(19)26/h11-12,14,17H,6-10,13,15H2,1-3H3 |
| InChIKey | GRJPOPAAEQYWRI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|