C12H22ClN3 — CID 107155778
2-chloro-4,4-dimethyl-N-(2-pyrazol-1-ylethyl)pentan-1-amine (PubChem CID 107155778) has the molecular formula C12H22ClN3 and a molecular weight of 243.78 g/mol. Its IUPAC name is 2-chloro-4,4-dimethyl-N-(2-pyrazol-1-ylethyl)pentan-1-amine.
| Compound Name | 2-chloro-4,4-dimethyl-N-(2-pyrazol-1-ylethyl)pentan-1-amine |
|---|---|
| PubChem CID | 107155778 |
| Molecular Formula | C12H22ClN3 |
| Molecular Weight | 243.78 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 2-chloro-4,4-dimethyl-N-(2-pyrazol-1-ylethyl)pentan-1-amine |
| SMILES | CC(C)(C)CC(Cl)CNCCn1cccn1 |
| InChI | InChI=1S/C12H22ClN3/c1-12(2,3)9-11(13)10-14-6-8-16-7-4-5-15-16/h4-5,7,11,14H,6,8-10H2,1-3H3 |
| InChIKey | WQXZHGNTJICQLT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.78 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|