C24H30N2O3 — CID 10715651
[(6aR,10aR)-7-methyl-6,6a,8,10a-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl 4-methoxycyclohexane-1-carboxylate (PubChem CID 10715651) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is [(6aR,10aR)-7-methyl-6,6a,8,10a-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl 4-methoxycyclohexane-1-carboxylate.
| Compound Name | [(6aR,10aR)-7-methyl-6,6a,8,10a-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl 4-methoxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 10715651 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | [(6aR,10aR)-7-methyl-6,6a,8,10a-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl 4-methoxycyclohexane-1-carboxylate |
| SMILES | COC1CCC(C(=O)OCC2=C[C@@H]3c4cccc5[nH]cc(c45)C[C@H]3N(C)C2)CC1 |
| InChI | InChI=1S/C24H30N2O3/c1-26-13-15(14-29-24(27)16-6-8-18(28-2)9-7-16)10-20-19-4-3-5-21-23(19)17(12-25-21)11-22(20)26/h3-5,10,12,16,18,20,22,25H,6-9,11,13-14H2,1-2H3/t16?,18?,20-,22-/m1/s1 |
| InChIKey | URYWDKUIRABTHD-VMPMBQFTSA-N |
| XLogP | 3.80 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|