C19H24N6O2S — CID 13369368
N-(2-azidoethyl)-N-[(7-methyl-6,6a,8,10a-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl)methyl]methanesulfonamide (PubChem CID 13369368) has the molecular formula C19H24N6O2S and a molecular weight of 400.51 g/mol. Its IUPAC name is N-(2-azidoethyl)-N-[(7-methyl-6,6a,8,10a-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl)methyl]methanesulfonamide.
| Compound Name | N-(2-azidoethyl)-N-[(7-methyl-6,6a,8,10a-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 13369368 |
| Molecular Formula | C19H24N6O2S |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | N-(2-azidoethyl)-N-[(7-methyl-6,6a,8,10a-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl)methyl]methanesulfonamide |
| SMILES | CN1CC(CN(CCN=[N+]=[N-])S(C)(=O)=O)=CC2c3cccc4[nH]cc(c34)CC21 |
| InChI | InChI=1S/C19H24N6O2S/c1-24-11-13(12-25(28(2,26)27)7-6-22-23-20)8-16-15-4-3-5-17-19(15)14(10-21-17)9-18(16)24/h3-5,8,10,16,18,21H,6-7,9,11-12H2,1-2H3 |
| InChIKey | KHWYJNRYIAULDT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|