C16H16N2O — CID 619846
7-methyl-9-methylidene-6,6a,10,10a-tetrahydro-4H-indolo[4,3-fg]quinolin-8-one (PubChem CID 619846) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is 7-methyl-9-methylidene-6,6a,10,10a-tetrahydro-4H-indolo[4,3-fg]quinolin-8-one.
| Compound Name | 7-methyl-9-methylidene-6,6a,10,10a-tetrahydro-4H-indolo[4,3-fg]quinolin-8-one |
|---|---|
| PubChem CID | 619846 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 7-methyl-9-methylidene-6,6a,10,10a-tetrahydro-4H-indolo[4,3-fg]quinolin-8-one |
| SMILES | C=C1CC2c3cccc4[nH]cc(c34)CC2N(C)C1=O |
| InChI | InChI=1S/C16H16N2O/c1-9-6-12-11-4-3-5-13-15(11)10(8-17-13)7-14(12)18(2)16(9)19/h3-5,8,12,14,17H,1,6-7H2,2H3 |
| InChIKey | GGYHKQLOIGTBLC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|