C18H24N2O3S — CID 88808467
[(6aR,9R)-7,9-dimethyl-4,6,6a,8,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]methyl methanesulfonate (PubChem CID 88808467) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is [(6aR,9R)-7,9-dimethyl-4,6,6a,8,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]methyl methanesulfonate.
| Compound Name | [(6aR,9R)-7,9-dimethyl-4,6,6a,8,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 88808467 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | [(6aR,9R)-7,9-dimethyl-4,6,6a,8,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]methyl methanesulfonate |
| SMILES | CN1C[C@](C)(COS(C)(=O)=O)CC2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C18H24N2O3S/c1-18(11-23-24(3,21)22)8-14-13-5-4-6-15-17(13)12(9-19-15)7-16(14)20(2)10-18/h4-6,9,14,16,19H,7-8,10-11H2,1-3H3/t14?,16-,18-/m1/s1 |
| InChIKey | DZLGXHFSEZGJNV-NBSGVIAVSA-N |
| XLogP | 2.49 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|