C17H22N2O — CID 70622855
[(6aR,9S,10aR)-7,9-dimethyl-4,6,6a,8,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]methanol (PubChem CID 70622855) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is [(6aR,9S,10aR)-7,9-dimethyl-4,6,6a,8,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]methanol.
| Compound Name | [(6aR,9S,10aR)-7,9-dimethyl-4,6,6a,8,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]methanol |
|---|---|
| PubChem CID | 70622855 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | [(6aR,9S,10aR)-7,9-dimethyl-4,6,6a,8,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]methanol |
| SMILES | CN1C[C@@](C)(CO)C[C@@H]2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C17H22N2O/c1-17(10-20)7-13-12-4-3-5-14-16(12)11(8-18-14)6-15(13)19(2)9-17/h3-5,8,13,15,18,20H,6-7,9-10H2,1-2H3/t13-,15-,17+/m1/s1 |
| InChIKey | QLLZOHIEOVODHU-UNEWFSDZSA-N |
| XLogP | 2.51 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |