C18H21N3 — CID 70622844
2-[(6aR,9S)-7,9-dimethyl-4,6,6a,8,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]acetonitrile (PubChem CID 70622844) has the molecular formula C18H21N3 and a molecular weight of 279.39 g/mol. Its IUPAC name is 2-[(6aR,9S)-7,9-dimethyl-4,6,6a,8,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]acetonitrile.
| Compound Name | 2-[(6aR,9S)-7,9-dimethyl-4,6,6a,8,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]acetonitrile |
|---|---|
| PubChem CID | 70622844 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 2-[(6aR,9S)-7,9-dimethyl-4,6,6a,8,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]acetonitrile |
| SMILES | CN1C[C@](C)(CC#N)CC2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C18H21N3/c1-18(6-7-19)9-14-13-4-3-5-15-17(13)12(10-20-15)8-16(14)21(2)11-18/h3-5,10,14,16,20H,6,8-9,11H2,1-2H3/t14?,16-,18-/m1/s1 |
| InChIKey | NKEUCBCVKZUXDL-NBSGVIAVSA-N |
| XLogP | 3.43 |
| TPSA | 42.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |