C16H22ClNOS — CID 107156979
N-(2-chloro-4,4-dimethylpentyl)-2,3-dihydro-1-benzothiophene-3-carboxamide (PubChem CID 107156979) has the molecular formula C16H22ClNOS and a molecular weight of 311.88 g/mol. Its IUPAC name is N-(2-chloro-4,4-dimethylpentyl)-2,3-dihydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-(2-chloro-4,4-dimethylpentyl)-2,3-dihydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 107156979 |
| Molecular Formula | C16H22ClNOS |
| Molecular Weight | 311.88 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | N-(2-chloro-4,4-dimethylpentyl)-2,3-dihydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)CC(Cl)CNC(=O)C1CSc2ccccc21 |
| InChI | InChI=1S/C16H22ClNOS/c1-16(2,3)8-11(17)9-18-15(19)13-10-20-14-7-5-4-6-12(13)14/h4-7,11,13H,8-10H2,1-3H3,(H,18,19) |
| InChIKey | KJSIKJXQUAEHDP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.88 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|