C12H22N4 — CID 107159268
1-N-(6-ethylpyrimidin-4-yl)-4-methylpentane-1,2-diamine (PubChem CID 107159268) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 1-N-(6-ethylpyrimidin-4-yl)-4-methylpentane-1,2-diamine.
| Compound Name | 1-N-(6-ethylpyrimidin-4-yl)-4-methylpentane-1,2-diamine |
|---|---|
| PubChem CID | 107159268 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 1-N-(6-ethylpyrimidin-4-yl)-4-methylpentane-1,2-diamine |
| SMILES | CCc1cc(NCC(N)CC(C)C)ncn1 |
| InChI | InChI=1S/C12H22N4/c1-4-11-6-12(16-8-15-11)14-7-10(13)5-9(2)3/h6,8-10H,4-5,7,13H2,1-3H3,(H,14,15,16) |
| InChIKey | JTGPSMZVUJCYOZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |