C11H20N4 — CID 107159425
4-methyl-1-N-(5-methylpyrimidin-2-yl)pentane-1,2-diamine (PubChem CID 107159425) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 4-methyl-1-N-(5-methylpyrimidin-2-yl)pentane-1,2-diamine.
| Compound Name | 4-methyl-1-N-(5-methylpyrimidin-2-yl)pentane-1,2-diamine |
|---|---|
| PubChem CID | 107159425 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 4-methyl-1-N-(5-methylpyrimidin-2-yl)pentane-1,2-diamine |
| SMILES | Cc1cnc(NCC(N)CC(C)C)nc1 |
| InChI | InChI=1S/C11H20N4/c1-8(2)4-10(12)7-15-11-13-5-9(3)6-14-11/h5-6,8,10H,4,7,12H2,1-3H3,(H,13,14,15) |
| InChIKey | OAFZJPZYZUOFJK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |