C13H24N2 — CID 107163558
N-[(1,4-dimethylpiperidin-4-yl)methyl]pent-1-yn-3-amine (PubChem CID 107163558) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperidin-4-yl)methyl]pent-1-yn-3-amine.
| Compound Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]pent-1-yn-3-amine |
|---|---|
| PubChem CID | 107163558 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]pent-1-yn-3-amine |
| SMILES | C#CC(CC)NCC1(C)CCN(C)CC1 |
| InChI | InChI=1S/C13H24N2/c1-5-12(6-2)14-11-13(3)7-9-15(4)10-8-13/h1,12,14H,6-11H2,2-4H3 |
| InChIKey | XNPSEACBKKNEOM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|