C15H22BrN3S — CID 107164143
4-bromo-2-[(1,4-dimethylpiperidin-4-yl)methylamino]benzenecarbothioamide (PubChem CID 107164143) has the molecular formula C15H22BrN3S and a molecular weight of 356.33 g/mol. Its IUPAC name is 4-bromo-2-[(1,4-dimethylpiperidin-4-yl)methylamino]benzenecarbothioamide.
| Compound Name | 4-bromo-2-[(1,4-dimethylpiperidin-4-yl)methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 107164143 |
| Molecular Formula | C15H22BrN3S |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 4-bromo-2-[(1,4-dimethylpiperidin-4-yl)methylamino]benzenecarbothioamide |
| SMILES | CN1CCC(C)(CNc2cc(Br)ccc2C(N)=S)CC1 |
| InChI | InChI=1S/C15H22BrN3S/c1-15(5-7-19(2)8-6-15)10-18-13-9-11(16)3-4-12(13)14(17)20/h3-4,9,18H,5-8,10H2,1-2H3,(H2,17,20) |
| InChIKey | CWDJXZAQNBAGHP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|