C14H22FNO3S — CID 107171159
2-ethyl-2-[(3-fluoro-4-methylphenoxy)methyl]butane-1-sulfonamide (PubChem CID 107171159) has the molecular formula C14H22FNO3S and a molecular weight of 303.40 g/mol. Its IUPAC name is 2-ethyl-2-[(3-fluoro-4-methylphenoxy)methyl]butane-1-sulfonamide.
| Compound Name | 2-ethyl-2-[(3-fluoro-4-methylphenoxy)methyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 107171159 |
| Molecular Formula | C14H22FNO3S |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-ethyl-2-[(3-fluoro-4-methylphenoxy)methyl]butane-1-sulfonamide |
| SMILES | CCC(CC)(COc1ccc(C)c(F)c1)CS(N)(=O)=O |
| InChI | InChI=1S/C14H22FNO3S/c1-4-14(5-2,10-20(16,17)18)9-19-12-7-6-11(3)13(15)8-12/h6-8H,4-5,9-10H2,1-3H3,(H2,16,17,18) |
| InChIKey | HPHMHCJOCQIGKD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |