C16H27NO3S — CID 65003897
2-ethyl-2-[(2,3,5-trimethylphenoxy)methyl]butane-1-sulfonamide (PubChem CID 65003897) has the molecular formula C16H27NO3S and a molecular weight of 313.46 g/mol. Its IUPAC name is 2-ethyl-2-[(2,3,5-trimethylphenoxy)methyl]butane-1-sulfonamide.
| Compound Name | 2-ethyl-2-[(2,3,5-trimethylphenoxy)methyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 65003897 |
| Molecular Formula | C16H27NO3S |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 2-ethyl-2-[(2,3,5-trimethylphenoxy)methyl]butane-1-sulfonamide |
| SMILES | CCC(CC)(COc1cc(C)cc(C)c1C)CS(N)(=O)=O |
| InChI | InChI=1S/C16H27NO3S/c1-6-16(7-2,11-21(17,18)19)10-20-15-9-12(3)8-13(4)14(15)5/h8-9H,6-7,10-11H2,1-5H3,(H2,17,18,19) |
| InChIKey | QNNVTHGIXQSIJV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |