C13H17Br2ClO3S — CID 65003988
2-[(2,4-dibromophenoxy)methyl]-2-ethylbutane-1-sulfonyl chloride (PubChem CID 65003988) has the molecular formula C13H17Br2ClO3S and a molecular weight of 448.60 g/mol. Its IUPAC name is 2-[(2,4-dibromophenoxy)methyl]-2-ethylbutane-1-sulfonyl chloride.
| Compound Name | 2-[(2,4-dibromophenoxy)methyl]-2-ethylbutane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 65003988 |
| Molecular Formula | C13H17Br2ClO3S |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 445.90 |
| IUPAC Name | 2-[(2,4-dibromophenoxy)methyl]-2-ethylbutane-1-sulfonyl chloride |
| SMILES | CCC(CC)(COc1ccc(Br)cc1Br)CS(=O)(=O)Cl |
| InChI | InChI=1S/C13H17Br2ClO3S/c1-3-13(4-2,9-20(16,17)18)8-19-12-6-5-10(14)7-11(12)15/h5-7H,3-4,8-9H2,1-2H3 |
| InChIKey | KRBHDXWTBYRQMP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |