C12H24N2O2S — CID 107172212
N-(1,1-dioxothian-4-yl)-N-methylazepan-4-amine (PubChem CID 107172212) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-N-methylazepan-4-amine.
| Compound Name | N-(1,1-dioxothian-4-yl)-N-methylazepan-4-amine |
|---|---|
| PubChem CID | 107172212 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-N-methylazepan-4-amine |
| SMILES | CN(C1CCCNCC1)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H24N2O2S/c1-14(11-3-2-7-13-8-4-11)12-5-9-17(15,16)10-6-12/h11-13H,2-10H2,1H3 |
| InChIKey | LEZZBFZAKCJXNU-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |