C12H24N2O2S — CID 79121119
4-N-(1,1-dioxothian-4-yl)-4-N-methylcyclohexane-1,4-diamine (PubChem CID 79121119) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is 4-N-(1,1-dioxothian-4-yl)-4-N-methylcyclohexane-1,4-diamine.
| Compound Name | 4-N-(1,1-dioxothian-4-yl)-4-N-methylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 79121119 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 4-N-(1,1-dioxothian-4-yl)-4-N-methylcyclohexane-1,4-diamine |
| SMILES | CN(C1CCC(N)CC1)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H24N2O2S/c1-14(11-4-2-10(13)3-5-11)12-6-8-17(15,16)9-7-12/h10-12H,2-9,13H2,1H3 |
| InChIKey | OSKLBDGJGXJJHQ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |