C9H18N2O2S — CID 66187291
N-(1,1-dioxothian-4-yl)-N-methylazetidin-3-amine (PubChem CID 66187291) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-N-methylazetidin-3-amine.
| Compound Name | N-(1,1-dioxothian-4-yl)-N-methylazetidin-3-amine |
|---|---|
| PubChem CID | 66187291 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-N-methylazetidin-3-amine |
| SMILES | CN(C1CCS(=O)(=O)CC1)C1CNC1 |
| InChI | InChI=1S/C9H18N2O2S/c1-11(9-6-10-7-9)8-2-4-14(12,13)5-3-8/h8-10H,2-7H2,1H3 |
| InChIKey | OQMCYJOHWMTYKG-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |