C8H16F3N3O2S — CID 107172813
N-(2,2,2-trifluoroethylsulfamoyl)azepan-4-amine (PubChem CID 107172813) has the molecular formula C8H16F3N3O2S and a molecular weight of 275.30 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethylsulfamoyl)azepan-4-amine.
| Compound Name | N-(2,2,2-trifluoroethylsulfamoyl)azepan-4-amine |
|---|---|
| PubChem CID | 107172813 |
| Molecular Formula | C8H16F3N3O2S |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | N-(2,2,2-trifluoroethylsulfamoyl)azepan-4-amine |
| SMILES | O=S(=O)(NCC(F)(F)F)NC1CCCNCC1 |
| InChI | InChI=1S/C8H16F3N3O2S/c9-8(10,11)6-13-17(15,16)14-7-2-1-4-12-5-3-7/h7,12-14H,1-6H2 |
| InChIKey | YKHPPBSTPFWCGS-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |