C16H20BrNO3 — CID 107175448
3-bromo-2-[(2,2-dimethylcyclohexanecarbonyl)amino]benzoic acid (PubChem CID 107175448) has the molecular formula C16H20BrNO3 and a molecular weight of 354.24 g/mol. Its IUPAC name is 3-bromo-2-[(2,2-dimethylcyclohexanecarbonyl)amino]benzoic acid.
| Compound Name | 3-bromo-2-[(2,2-dimethylcyclohexanecarbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 107175448 |
| Molecular Formula | C16H20BrNO3 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 3-bromo-2-[(2,2-dimethylcyclohexanecarbonyl)amino]benzoic acid |
| SMILES | CC1(C)CCCCC1C(=O)Nc1c(Br)cccc1C(=O)O |
| InChI | InChI=1S/C16H20BrNO3/c1-16(2)9-4-3-7-11(16)14(19)18-13-10(15(20)21)6-5-8-12(13)17/h5-6,8,11H,3-4,7,9H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | GHLWWIZNMFSWBQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |