C23H29ClO6 — CID 10717815
[(1R,3aS,3bR,4S,5S,9aR,9bS,11aS)-5-chloro-9a,11a-dimethyl-5',7-dioxospiro[2,3,3a,3b,4,5,9,9b,10,11-decahydroindeno[4,5-h]isochromene-1,2'-oxolane]-4-yl] acetate (PubChem CID 10717815) has the molecular formula C23H29ClO6 and a molecular weight of 436.93 g/mol. Its IUPAC name is [(1R,3aS,3bR,4S,5S,9aR,9bS,11aS)-5-chloro-9a,11a-dimethyl-5',7-dioxospiro[2,3,3a,3b,4,5,9,9b,10,11-decahydroindeno[4,5-h]isochromene-1,2'-oxolane]-4-yl] acetate.
| Compound Name | [(1R,3aS,3bR,4S,5S,9aR,9bS,11aS)-5-chloro-9a,11a-dimethyl-5',7-dioxospiro[2,3,3a,3b,4,5,9,9b,10,11-decahydroindeno[4,5-h]isochromene-1,2'-oxolane]-4-yl] acetate |
|---|---|
| PubChem CID | 10717815 |
| Molecular Formula | C23H29ClO6 |
| Molecular Weight | 436.93 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | [(1R,3aS,3bR,4S,5S,9aR,9bS,11aS)-5-chloro-9a,11a-dimethyl-5',7-dioxospiro[2,3,3a,3b,4,5,9,9b,10,11-decahydroindeno[4,5-h]isochromene-1,2'-oxolane]-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H]2[C@H](CC[C@@]3(C)[C@H]2CC[C@@]32CCC(=O)O2)[C@@]2(C)COC(=O)C=C2[C@@H]1Cl |
| InChI | InChI=1S/C23H29ClO6/c1-12(25)29-20-18-13(21(2)11-28-17(27)10-15(21)19(20)24)4-7-22(3)14(18)5-8-23(22)9-6-16(26)30-23/h10,13-14,18-20H,4-9,11H2,1-3H3/t13-,14-,18+,19-,20-,21+,22-,23+/m0/s1 |
| InChIKey | YCCBWTKUDPOMMO-BACXCUMJSA-N |
| XLogP | 3.55 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.93 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|