C22H26O4 — CID 10665833
(1R,2S,4R,10R,11S,14S,15R,18S)-10,14-dimethylspiro[3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadeca-5,8-diene-15,5'-oxolane]-2',7-dione (PubChem CID 10665833) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is (1R,2S,4R,10R,11S,14S,15R,18S)-10,14-dimethylspiro[3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadeca-5,8-diene-15,5'-oxolane]-2',7-dione.
| Compound Name | (1R,2S,4R,10R,11S,14S,15R,18S)-10,14-dimethylspiro[3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadeca-5,8-diene-15,5'-oxolane]-2',7-dione |
|---|---|
| PubChem CID | 10665833 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (1R,2S,4R,10R,11S,14S,15R,18S)-10,14-dimethylspiro[3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadeca-5,8-diene-15,5'-oxolane]-2',7-dione |
| SMILES | C[C@]12C=CC(=O)C=C1[C@H]1O[C@H]1[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]21CCC(=O)O1 |
| InChI | InChI=1S/C22H26O4/c1-20-7-3-12(23)11-15(20)18-19(25-18)17-13(20)4-8-21(2)14(17)5-9-22(21)10-6-16(24)26-22/h3,7,11,13-14,17-19H,4-6,8-10H2,1-2H3/t13-,14-,17+,18+,19-,20+,21-,22+/m0/s1 |
| InChIKey | QADTXUIKLLNYHD-VRQGMAQHSA-N |
| XLogP | 3.36 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|