C24H29FO3 — CID 46241821
CID 46241821 (PubChem CID 46241821) has the molecular formula C24H29FO3 and a molecular weight of 384.49 g/mol.
| Compound Name | CID 46241821 |
|---|---|
| PubChem CID | 46241821 |
| Molecular Formula | C24H29FO3 |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | — |
| SMILES | C[C@]12C=CC(=O)C=C1C1(CC1)CC1C2C(F)C[C@@]2(C)C1CC[C@@]21CCC(=O)O1 |
| InChI | InChI=1S/C24H29FO3/c1-21-6-3-14(26)11-18(21)23(9-10-23)12-15-16-4-7-24(8-5-19(27)28-24)22(16,2)13-17(25)20(15)21/h3,6,11,15-17,20H,4-5,7-10,12-13H2,1-2H3/t15?,16?,17?,20?,21-,22-,24+/m0/s1 |
| InChIKey | ZZONQUNAXKYLOX-ZLZQSXDCSA-N |
| XLogP | 4.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |