About CID 91064608
CID 91064608 (PubChem CID 91064608) has the molecular formula C26H32O3
and a molecular weight of 392.54 g/mol.
Molecular Properties
| Compound Name | CID 91064608 |
| PubChem CID | 91064608 |
| Molecular Formula | C26H32O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | — |
| SMILES | CC12C3=CCC4(C)C(CCC45CCC(=O)O5)C3CC3(CC3)C1=CC(=O)C1CCC12 |
| InChI | InChI=1S/C26H32O3/c1-23-8-5-19-16(17(23)6-9-26(23)10-7-22(28)29-26)14-25(11-12-25)21-13-20(27)15-3-4-18(15)24(19,21)2/h5,13,15-18H,3-4,6-12,14H2,1-2H3 |
| InChIKey | AJIGZGQGKKZMTL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 91064608 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91064608?
The IUPAC name of CID 91064608 (CID 91064608) is not available.
What is the SMILES notation for CID 91064608?
The canonical SMILES for CID 91064608 is CC12C3=CCC4(C)C(CCC45CCC(=O)O5)C3CC3(CC3)C1=CC(=O)C1CCC12.
What is the InChIKey of CID 91064608?
The InChIKey is AJIGZGQGKKZMTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32O3/c1-23-8-5-19-16(17(23)6-9-26(23)10-7-22(28)29-26)14-25(11-12-25)21-13-20(27)15-3-4-18(15)24(19,21)2/h5,13,15-18H,3-4,6-12,14H2,1-2H3.
What are the key properties of CID 91064608?
CID 91064608 has a molecular weight of 392.54 g/mol, XLogP of 5.15, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91064608 is sourced from PubChem (CID 91064608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).