C26H32O3 — CID 91064608
CID 91064608 (PubChem CID 91064608) has the molecular formula C26H32O3 and a molecular weight of 392.54 g/mol.
| Compound Name | CID 91064608 |
|---|---|
| PubChem CID | 91064608 |
| Molecular Formula | C26H32O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | — |
| SMILES | CC12C3=CCC4(C)C(CCC45CCC(=O)O5)C3CC3(CC3)C1=CC(=O)C1CCC12 |
| InChI | InChI=1S/C26H32O3/c1-23-8-5-19-16(17(23)6-9-26(23)10-7-22(28)29-26)14-25(11-12-25)21-13-20(27)15-3-4-18(15)24(19,21)2/h5,13,15-18H,3-4,6-12,14H2,1-2H3 |
| InChIKey | AJIGZGQGKKZMTL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|