C24H29NO7 — CID 10718100
dimethyl (5R)-2-benzyl-5-[(1S)-1-(phenylmethoxymethoxy)ethyl]-1,2-oxazolidine-4,4-dicarboxylate (PubChem CID 10718100) has the molecular formula C24H29NO7 and a molecular weight of 443.50 g/mol. Its IUPAC name is dimethyl (5R)-2-benzyl-5-[(1S)-1-(phenylmethoxymethoxy)ethyl]-1,2-oxazolidine-4,4-dicarboxylate.
| Compound Name | dimethyl (5R)-2-benzyl-5-[(1S)-1-(phenylmethoxymethoxy)ethyl]-1,2-oxazolidine-4,4-dicarboxylate |
|---|---|
| PubChem CID | 10718100 |
| Molecular Formula | C24H29NO7 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | dimethyl (5R)-2-benzyl-5-[(1S)-1-(phenylmethoxymethoxy)ethyl]-1,2-oxazolidine-4,4-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CN(Cc2ccccc2)O[C@H]1[C@H](C)OCOCc1ccccc1 |
| InChI | InChI=1S/C24H29NO7/c1-18(31-17-30-15-20-12-8-5-9-13-20)21-24(22(26)28-2,23(27)29-3)16-25(32-21)14-19-10-6-4-7-11-19/h4-13,18,21H,14-17H2,1-3H3/t18-,21-/m0/s1 |
| InChIKey | MTWKIFNDOKIPHX-RXVVDRJESA-N |
| XLogP | 2.71 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|