C19H23Br — CID 107183620
2-[2-bromo-2-(2,2-dimethylcyclopentyl)ethyl]naphthalene (PubChem CID 107183620) has the molecular formula C19H23Br and a molecular weight of 331.30 g/mol. Its IUPAC name is 2-[2-bromo-2-(2,2-dimethylcyclopentyl)ethyl]naphthalene.
| Compound Name | 2-[2-bromo-2-(2,2-dimethylcyclopentyl)ethyl]naphthalene |
|---|---|
| PubChem CID | 107183620 |
| Molecular Formula | C19H23Br |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-[2-bromo-2-(2,2-dimethylcyclopentyl)ethyl]naphthalene |
| SMILES | CC1(C)CCCC1C(Br)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H23Br/c1-19(2)11-5-8-17(19)18(20)13-14-9-10-15-6-3-4-7-16(15)12-14/h3-4,6-7,9-10,12,17-18H,5,8,11,13H2,1-2H3 |
| InChIKey | ZJHFGDPAMVTZCT-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|