C12H19BrN2 — CID 107182298
2-[2-bromo-2-(2,2-dimethylcyclopentyl)ethyl]-1H-imidazole (PubChem CID 107182298) has the molecular formula C12H19BrN2 and a molecular weight of 271.20 g/mol. Its IUPAC name is 2-[2-bromo-2-(2,2-dimethylcyclopentyl)ethyl]-1H-imidazole.
| Compound Name | 2-[2-bromo-2-(2,2-dimethylcyclopentyl)ethyl]-1H-imidazole |
|---|---|
| PubChem CID | 107182298 |
| Molecular Formula | C12H19BrN2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-[2-bromo-2-(2,2-dimethylcyclopentyl)ethyl]-1H-imidazole |
| SMILES | CC1(C)CCCC1C(Br)Cc1ncc[nH]1 |
| InChI | InChI=1S/C12H19BrN2/c1-12(2)5-3-4-9(12)10(13)8-11-14-6-7-15-11/h6-7,9-10H,3-5,8H2,1-2H3,(H,14,15) |
| InChIKey | XUGIXSHIIBQZSN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|