C15H17BrN2 — CID 62719865
2-[2-bromo-2-(1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]-1H-imidazole (PubChem CID 62719865) has the molecular formula C15H17BrN2 and a molecular weight of 305.22 g/mol. Its IUPAC name is 2-[2-bromo-2-(1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]-1H-imidazole.
| Compound Name | 2-[2-bromo-2-(1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]-1H-imidazole |
|---|---|
| PubChem CID | 62719865 |
| Molecular Formula | C15H17BrN2 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-[2-bromo-2-(1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]-1H-imidazole |
| SMILES | BrC(Cc1ncc[nH]1)C1CCCc2ccccc21 |
| InChI | InChI=1S/C15H17BrN2/c16-14(10-15-17-8-9-18-15)13-7-3-5-11-4-1-2-6-12(11)13/h1-2,4,6,8-9,13-14H,3,5,7,10H2,(H,17,18) |
| InChIKey | PEUJMEODUFCTTC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|