C9H14N2O — CID 61083393
1-cyclobutyl-2-(1H-imidazol-2-yl)ethanol (PubChem CID 61083393) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-cyclobutyl-2-(1H-imidazol-2-yl)ethanol.
| Compound Name | 1-cyclobutyl-2-(1H-imidazol-2-yl)ethanol |
|---|---|
| PubChem CID | 61083393 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 1-cyclobutyl-2-(1H-imidazol-2-yl)ethanol |
| SMILES | OC(Cc1ncc[nH]1)C1CCC1 |
| InChI | InChI=1S/C9H14N2O/c12-8(7-2-1-3-7)6-9-10-4-5-11-9/h4-5,7-8,12H,1-3,6H2,(H,10,11) |
| InChIKey | NZUQHHIESWSYKM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |