C13H16Br2 — CID 107003144
1-bromo-3-[2-bromo-2-(2,2-dimethylcyclopropyl)ethyl]benzene (PubChem CID 107003144) has the molecular formula C13H16Br2 and a molecular weight of 332.08 g/mol. Its IUPAC name is 1-bromo-3-[2-bromo-2-(2,2-dimethylcyclopropyl)ethyl]benzene.
| Compound Name | 1-bromo-3-[2-bromo-2-(2,2-dimethylcyclopropyl)ethyl]benzene |
|---|---|
| PubChem CID | 107003144 |
| Molecular Formula | C13H16Br2 |
| Molecular Weight | 332.08 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | 1-bromo-3-[2-bromo-2-(2,2-dimethylcyclopropyl)ethyl]benzene |
| SMILES | CC1(C)CC1C(Br)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C13H16Br2/c1-13(2)8-11(13)12(15)7-9-4-3-5-10(14)6-9/h3-6,11-12H,7-8H2,1-2H3 |
| InChIKey | MIXHPRKZEJJSCH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.08 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|