C16H19ClN2O — CID 107185895
4-(2-chlorophenyl)-5-(2,2-dimethylcyclopentyl)-1,2-oxazol-3-amine (PubChem CID 107185895) has the molecular formula C16H19ClN2O and a molecular weight of 290.79 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-5-(2,2-dimethylcyclopentyl)-1,2-oxazol-3-amine.
| Compound Name | 4-(2-chlorophenyl)-5-(2,2-dimethylcyclopentyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 107185895 |
| Molecular Formula | C16H19ClN2O |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 4-(2-chlorophenyl)-5-(2,2-dimethylcyclopentyl)-1,2-oxazol-3-amine |
| SMILES | CC1(C)CCCC1c1onc(N)c1-c1ccccc1Cl |
| InChI | InChI=1S/C16H19ClN2O/c1-16(2)9-5-7-11(16)14-13(15(18)19-20-14)10-6-3-4-8-12(10)17/h3-4,6,8,11H,5,7,9H2,1-2H3,(H2,18,19) |
| InChIKey | OYGZEQBTMOPXKL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |