C14H18ClN3O3 — CID 107186554
N-(6-chloro-3-nitro-2-pyridinyl)-2,2-dimethylcyclohexane-1-carboxamide (PubChem CID 107186554) has the molecular formula C14H18ClN3O3 and a molecular weight of 311.77 g/mol. Its IUPAC name is N-(6-chloro-3-nitro-2-pyridinyl)-2,2-dimethylcyclohexane-1-carboxamide.
| Compound Name | N-(6-chloro-3-nitro-2-pyridinyl)-2,2-dimethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 107186554 |
| Molecular Formula | C14H18ClN3O3 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | N-(6-chloro-3-nitro-2-pyridinyl)-2,2-dimethylcyclohexane-1-carboxamide |
| SMILES | CC1(C)CCCCC1C(=O)Nc1nc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18ClN3O3/c1-14(2)8-4-3-5-9(14)13(19)17-12-10(18(20)21)6-7-11(15)16-12/h6-7,9H,3-5,8H2,1-2H3,(H,16,17,19) |
| InChIKey | SOKZZPFCCNRZMO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|