C12H12Cl2N2O3S — CID 107188928
(2,3-dichloro-5-nitrophenyl)-(3-methylthiomorpholin-4-yl)methanone (PubChem CID 107188928) has the molecular formula C12H12Cl2N2O3S and a molecular weight of 335.21 g/mol. Its IUPAC name is (2,3-dichloro-5-nitrophenyl)-(3-methylthiomorpholin-4-yl)methanone.
| Compound Name | (2,3-dichloro-5-nitrophenyl)-(3-methylthiomorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 107188928 |
| Molecular Formula | C12H12Cl2N2O3S |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | (2,3-dichloro-5-nitrophenyl)-(3-methylthiomorpholin-4-yl)methanone |
| SMILES | CC1CSCCN1C(=O)c1cc([N+](=O)[O-])cc(Cl)c1Cl |
| InChI | InChI=1S/C12H12Cl2N2O3S/c1-7-6-20-3-2-15(7)12(17)9-4-8(16(18)19)5-10(13)11(9)14/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | FCUPISBFMFTYJF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|