C15H18O2 — CID 107192946
1-benzofuran-2-yl-(2-methylcyclopentyl)methanol (PubChem CID 107192946) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-benzofuran-2-yl-(2-methylcyclopentyl)methanol.
| Compound Name | 1-benzofuran-2-yl-(2-methylcyclopentyl)methanol |
|---|---|
| PubChem CID | 107192946 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 1-benzofuran-2-yl-(2-methylcyclopentyl)methanol |
| SMILES | CC1CCCC1C(O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C15H18O2/c1-10-5-4-7-12(10)15(16)14-9-11-6-2-3-8-13(11)17-14/h2-3,6,8-10,12,15-16H,4-5,7H2,1H3 |
| InChIKey | MNFBKLVTJCHEIE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |