C17H23NO2 — CID 62123428
1-(1-benzofuran-2-yl)-2-(2,3-dimethylpiperidin-1-yl)ethanol (PubChem CID 62123428) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-2-(2,3-dimethylpiperidin-1-yl)ethanol.
| Compound Name | 1-(1-benzofuran-2-yl)-2-(2,3-dimethylpiperidin-1-yl)ethanol |
|---|---|
| PubChem CID | 62123428 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-2-(2,3-dimethylpiperidin-1-yl)ethanol |
| SMILES | CC1CCCN(CC(O)c2cc3ccccc3o2)C1C |
| InChI | InChI=1S/C17H23NO2/c1-12-6-5-9-18(13(12)2)11-15(19)17-10-14-7-3-4-8-16(14)20-17/h3-4,7-8,10,12-13,15,19H,5-6,9,11H2,1-2H3 |
| InChIKey | ABZFCQUZDCCLFE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |