C16H17NO4 — CID 79179188
1-[2-(1-benzofuran-2-yl)-2-hydroxyethyl]-3,4-dimethylpyrrolidine-2,5-dione (PubChem CID 79179188) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is 1-[2-(1-benzofuran-2-yl)-2-hydroxyethyl]-3,4-dimethylpyrrolidine-2,5-dione.
| Compound Name | 1-[2-(1-benzofuran-2-yl)-2-hydroxyethyl]-3,4-dimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 79179188 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 1-[2-(1-benzofuran-2-yl)-2-hydroxyethyl]-3,4-dimethylpyrrolidine-2,5-dione |
| SMILES | CC1C(=O)N(CC(O)c2cc3ccccc3o2)C(=O)C1C |
| InChI | InChI=1S/C16H17NO4/c1-9-10(2)16(20)17(15(9)19)8-12(18)14-7-11-5-3-4-6-13(11)21-14/h3-7,9-10,12,18H,8H2,1-2H3 |
| InChIKey | GFSZNDDYOHRFMZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|