C16H19NO4S — CID 136585973
(1R)-2-[(3aR,6aS)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrol-5-yl]-1-(1-benzofuran-2-yl)ethanol (PubChem CID 136585973) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is (1R)-2-[(3aR,6aS)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrol-5-yl]-1-(1-benzofuran-2-yl)ethanol.
| Compound Name | (1R)-2-[(3aR,6aS)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrol-5-yl]-1-(1-benzofuran-2-yl)ethanol |
|---|---|
| PubChem CID | 136585973 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (1R)-2-[(3aR,6aS)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrol-5-yl]-1-(1-benzofuran-2-yl)ethanol |
| SMILES | O=S1(=O)C[C@H]2CN(C[C@@H](O)c3cc4ccccc4o3)C[C@H]2C1 |
| InChI | InChI=1S/C16H19NO4S/c18-14(16-5-11-3-1-2-4-15(11)21-16)8-17-6-12-9-22(19,20)10-13(12)7-17/h1-5,12-14,18H,6-10H2/t12-,13+,14-/m1/s1 |
| InChIKey | HJRGHMQTCLFVKS-HZSPNIEDSA-N |
| XLogP | 1.44 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |