C9H13BrN2S — CID 107195213
3-bromo-5-(2,2-dimethylcyclopentyl)-1,2,4-thiadiazole (PubChem CID 107195213) has the molecular formula C9H13BrN2S and a molecular weight of 261.19 g/mol. Its IUPAC name is 3-bromo-5-(2,2-dimethylcyclopentyl)-1,2,4-thiadiazole.
| Compound Name | 3-bromo-5-(2,2-dimethylcyclopentyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 107195213 |
| Molecular Formula | C9H13BrN2S |
| Molecular Weight | 261.19 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 3-bromo-5-(2,2-dimethylcyclopentyl)-1,2,4-thiadiazole |
| SMILES | CC1(C)CCCC1c1nc(Br)ns1 |
| InChI | InChI=1S/C9H13BrN2S/c1-9(2)5-3-4-6(9)7-11-8(10)12-13-7/h6H,3-5H2,1-2H3 |
| InChIKey | XCFXFGQAXYVYOU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.19 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |