About N-(2-aminoethyl)-N'-(5-hydroxypentyl)-N'-methyloxamide
N-(2-aminoethyl)-N'-(5-hydroxypentyl)-N'-methyloxamide (PubChem CID 107197511) has the molecular formula C10H21N3O3
and a molecular weight of 231.30 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-(5-hydroxypentyl)-N'-methyloxamide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-N'-(5-hydroxypentyl)-N'-methyloxamide |
| PubChem CID | 107197511 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | N-(2-aminoethyl)-N'-(5-hydroxypentyl)-N'-methyloxamide |
| SMILES | CN(CCCCCO)C(=O)C(=O)NCCN |
| InChI | InChI=1S/C10H21N3O3/c1-13(7-3-2-4-8-14)10(16)9(15)12-6-5-11/h14H,2-8,11H2,1H3,(H,12,15) |
| InChIKey | BPYXVVUMGLKSCT-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminoethyl)-N'-(5-hydroxypentyl)-N'-methyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-N'-(5-hydroxypentyl)-N'-methyloxamide?
The IUPAC name of N-(2-aminoethyl)-N'-(5-hydroxypentyl)-N'-methyloxamide (CID 107197511) is N-(2-aminoethyl)-N'-(5-hydroxypentyl)-N'-methyloxamide.
What is the SMILES notation for N-(2-aminoethyl)-N'-(5-hydroxypentyl)-N'-methyloxamide?
The canonical SMILES for N-(2-aminoethyl)-N'-(5-hydroxypentyl)-N'-methyloxamide is CN(CCCCCO)C(=O)C(=O)NCCN.
What is the InChIKey of N-(2-aminoethyl)-N'-(5-hydroxypentyl)-N'-methyloxamide?
The InChIKey is BPYXVVUMGLKSCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O3/c1-13(7-3-2-4-8-14)10(16)9(15)12-6-5-11/h14H,2-8,11H2,1H3,(H,12,15).
What are the key properties of N-(2-aminoethyl)-N'-(5-hydroxypentyl)-N'-methyloxamide?
N-(2-aminoethyl)-N'-(5-hydroxypentyl)-N'-methyloxamide has a molecular weight of 231.30 g/mol, XLogP of -1.32, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-N'-(5-hydroxypentyl)-N'-methyloxamide is sourced from PubChem (CID 107197511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).